C5H10N2O — CID 18008153
1-(4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 18008153) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 1-(4,5-dihydroimidazol-1-yl)ethanol.
| Compound Name | 1-(4,5-dihydroimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 18008153 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 1-(4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | CC(O)N1C=NCC1 |
| InChI | InChI=1S/C5H10N2O/c1-5(8)7-3-2-6-4-7/h4-5,8H,2-3H2,1H3 |
| InChIKey | YUFLXDLVTAPPHN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |