C22H35N3O4 — CID 18015415
tert-butyl N-[2-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate (PubChem CID 18015415) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015415 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(butylamino)-1-(3-methylphenyl)-2-oxoethyl]-ethylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCNC(=O)C(c1cccc(C)c1)N(CC)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O4/c1-7-9-13-23-20(27)19(17-12-10-11-16(3)14-17)25(8-2)18(26)15-24-21(28)29-22(4,5)6/h10-12,14,19H,7-9,13,15H2,1-6H3,(H,23,27)(H,24,28) |
| InChIKey | SEOXRMCKRMSUPC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|