C29H49N3O4 — CID 18020665
tert-butyl N-[2-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate (PubChem CID 18020665) has the molecular formula C29H49N3O4 and a molecular weight of 503.73 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020665 |
| Molecular Formula | C29H49N3O4 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.37 |
| IUPAC Name | tert-butyl N-[2-[[2-(butylamino)-1-(3,5-dimethylphenyl)-2-oxoethyl]-octylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NCCCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C29H49N3O4/c1-8-10-12-13-14-15-17-32(25(33)21-31-28(35)36-29(5,6)7)26(27(34)30-16-11-9-2)24-19-22(3)18-23(4)20-24/h18-20,26H,8-17,21H2,1-7H3,(H,30,34)(H,31,35) |
| InChIKey | PJZQWXRCKSUSTC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|