C26H43N3O4 — CID 18018387
tert-butyl N-[2-[tert-butyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18018387) has the molecular formula C26H43N3O4 and a molecular weight of 461.65 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18018387 |
| Molecular Formula | C26H43N3O4 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl-[1-(3,5-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cc(C)cc(C)c1)N(C(=O)CNC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H43N3O4/c1-10-11-12-13-27-23(31)22(20-15-18(2)14-19(3)16-20)29(25(4,5)6)21(30)17-28-24(32)33-26(7,8)9/h14-16,22H,10-13,17H2,1-9H3,(H,27,31)(H,28,32) |
| InChIKey | RREWEENGYRBPEN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|