C27H45N3O4 — CID 18019241
tert-butyl N-[2-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-2-oxoethyl]carbamate (PubChem CID 18019241) has the molecular formula C27H45N3O4 and a molecular weight of 475.67 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019241 |
| Molecular Formula | C27H45N3O4 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.34 |
| IUPAC Name | tert-butyl N-[2-[[1-(3,5-dimethylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-pentylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)NC(C)CCC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C27H45N3O4/c1-9-11-12-14-30(23(31)18-28-26(33)34-27(6,7)8)24(25(32)29-21(5)13-10-2)22-16-19(3)15-20(4)17-22/h15-17,21,24H,9-14,18H2,1-8H3,(H,28,33)(H,29,32) |
| InChIKey | RFXGHUJYEOZUPK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|