C26H41N3O4 — CID 18018641
tert-butyl N-[2-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18018641) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is tert-butyl N-[2-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18018641 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | tert-butyl N-[2-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-2-oxoethyl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NC(C)CCC)N(CCCC)C(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H41N3O4/c1-8-11-16-29(22(30)18-27-25(32)33-26(5,6)7)23(24(31)28-19(4)13-9-2)21-15-12-14-20(10-3)17-21/h10,12,14-15,17,19,23H,3,8-9,11,13,16,18H2,1-2,4-7H3,(H,27,32)(H,28,31) |
| InChIKey | WCUBQKOPVRKILO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |