C32H41N3O4 — CID 18019696
tert-butyl N-[2-[hexyl-[1-(3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18019696) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is tert-butyl N-[2-[hexyl-[1-(3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[hexyl-[1-(3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019696 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | tert-butyl N-[2-[hexyl-[1-(3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(C)c1 |
| InChI | InChI=1S/C32H41N3O4/c1-6-7-8-11-19-35(28(36)22-33-31(38)39-32(3,4)5)29(26-16-12-13-23(2)20-26)30(37)34-27-18-17-24-14-9-10-15-25(24)21-27/h9-10,12-18,20-21,29H,6-8,11,19,22H2,1-5H3,(H,33,38)(H,34,37) |
| InChIKey | KRDSNIDDFHJUNW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|