C32H41N3O4 — CID 18019321
tert-butyl N-[2-[[1-(2,6-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate (PubChem CID 18019321) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(2,6-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(2,6-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019321 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | tert-butyl N-[2-[[1-(2,6-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1c(C)cccc1C |
| InChI | InChI=1S/C32H41N3O4/c1-7-8-11-19-35(27(36)21-33-31(38)39-32(4,5)6)29(28-22(2)13-12-14-23(28)3)30(37)34-26-18-17-24-15-9-10-16-25(24)20-26/h9-10,12-18,20,29H,7-8,11,19,21H2,1-6H3,(H,33,38)(H,34,37) |
| InChIKey | GEVGTDXGANWNFJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|