C31H39N3O5 — CID 18019351
tert-butyl N-[2-[[1-(4-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate (PubChem CID 18019351) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(4-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(4-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019351 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | tert-butyl N-[2-[[1-(4-hydroxy-3-methylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C31H39N3O5/c1-6-7-10-17-34(27(36)20-32-30(38)39-31(3,4)5)28(24-14-16-26(35)21(2)18-24)29(37)33-25-15-13-22-11-8-9-12-23(22)19-25/h8-9,11-16,18-19,28,35H,6-7,10,17,20H2,1-5H3,(H,32,38)(H,33,37) |
| InChIKey | GOWPTVQKOYWMMZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|