C27H43N3O5S — CID 18027897
tert-butyl N-[1-[[1-(4-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18027897) has the molecular formula C27H43N3O5S and a molecular weight of 521.72 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18027897 |
| Molecular Formula | C27H43N3O5S |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-prop-2-enylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCN(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C27H43N3O5S/c1-8-10-11-15-28-24(32)23(20-12-13-22(31)19(3)18-20)30(16-9-2)25(33)21(14-17-36-7)29-26(34)35-27(4,5)6/h9,12-13,18,21,23,31H,2,8,10-11,14-17H2,1,3-7H3,(H,28,32)(H,29,34) |
| InChIKey | FUEDFZWOIMJQFB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|