C23H33N5O6 — CID 18050154
tert-butyl N-[4-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18050154) has the molecular formula C23H33N5O6 and a molecular weight of 475.55 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18050154 |
| Molecular Formula | C23H33N5O6 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(tert-butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]-(cyanomethyl)amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)NC(=O)C(c1ccccc1O)N(CC#N)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33N5O6/c1-22(2,3)27-19(31)18(14-9-7-8-10-16(14)29)28(12-11-24)20(32)15(13-17(25)30)26-21(33)34-23(4,5)6/h7-10,15,18,29H,12-13H2,1-6H3,(H2,25,30)(H,26,33)(H,27,31) |
| InChIKey | ZPSFLCXPXOQIFW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 174.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|