About prop-2-enyl carbonochloridate
prop-2-enyl carbonochloridate (PubChem CID 18052) has the molecular formula C4H5ClO2
and a molecular weight of 120.53 g/mol. Its IUPAC name is prop-2-enyl carbonochloridate.
Molecular Properties
| Compound Name | prop-2-enyl carbonochloridate |
| PubChem CID | 18052 |
| Molecular Formula | C4H5ClO2 |
| Molecular Weight | 120.53 g/mol |
| Exact Mass | 120.00 |
| IUPAC Name | prop-2-enyl carbonochloridate |
| SMILES | C=CCOC(=O)Cl |
| InChI | InChI=1S/C4H5ClO2/c1-2-3-7-4(5)6/h2H,1,3H2 |
| InChIKey | CAEWJEXPFKNBQL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl carbonochloridate?
The IUPAC name of prop-2-enyl carbonochloridate (CID 18052) is prop-2-enyl carbonochloridate.
What is the SMILES notation for prop-2-enyl carbonochloridate?
The canonical SMILES for prop-2-enyl carbonochloridate is C=CCOC(=O)Cl.
What is the InChIKey of prop-2-enyl carbonochloridate?
The InChIKey is CAEWJEXPFKNBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO2/c1-2-3-7-4(5)6/h2H,1,3H2.
What are the key properties of prop-2-enyl carbonochloridate?
prop-2-enyl carbonochloridate has a molecular weight of 120.53 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl carbonochloridate is sourced from PubChem (CID 18052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).