C30H43N3O6S — CID 18060199
tert-butyl N-[1-[heptyl-[1-(3-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18060199) has the molecular formula C30H43N3O6S and a molecular weight of 573.76 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[1-(3-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[1-(3-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18060199 |
| Molecular Formula | C30H43N3O6S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[1-(3-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C30H43N3O6S/c1-6-7-8-9-10-18-33(28(36)25(20-40)32-29(37)39-30(2,3)4)26(21-12-11-13-23(34)19-21)27(35)31-22-14-16-24(38-5)17-15-22/h11-17,19,25-26,34,40H,6-10,18,20H2,1-5H3,(H,31,35)(H,32,37) |
| InChIKey | QZQLKXPYVDKAHA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|