C26H42N4O6 — CID 18063835
tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18063835) has the molecular formula C26H42N4O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18063835 |
| Molecular Formula | C26H42N4O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-hydroxyphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccccc1O)N(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H42N4O6/c1-8-9-16-28-22(33)21(17-12-10-11-13-19(17)31)30(25(2,3)4)23(34)18(14-15-20(27)32)29-24(35)36-26(5,6)7/h10-13,18,21,31H,8-9,14-16H2,1-7H3,(H2,27,32)(H,28,33)(H,29,35) |
| InChIKey | KCPWXIJFKZWPPV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|