C28H42N4O5 — CID 18063940
tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 18063940) has the molecular formula C28H42N4O5 and a molecular weight of 514.67 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18063940 |
| Molecular Formula | C28H42N4O5 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | tert-butyl N-[5-amino-1-[tert-butyl-[2-(butylamino)-1-(2-ethynylphenyl)-2-oxoethyl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccccc1C(C(=O)NCCCC)N(C(=O)C(CCC(N)=O)NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H42N4O5/c1-9-11-18-30-24(34)23(20-15-13-12-14-19(20)10-2)32(27(3,4)5)25(35)21(16-17-22(29)33)31-26(36)37-28(6,7)8/h2,12-15,21,23H,9,11,16-18H2,1,3-8H3,(H2,29,33)(H,30,34)(H,31,36) |
| InChIKey | JVHGKYYJDRULSU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|