C20H27N3O3S — CID 18083188
N-(cyclohexylmethyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 18083188) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18083188 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[3-(3-hydroxypropyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CCCO)NCC1CCCCC1 |
| InChI | InChI=1S/C20H27N3O3S/c24-12-6-11-23-19(26)16-9-4-5-10-17(16)22-20(23)27-14-18(25)21-13-15-7-2-1-3-8-15/h4-5,9-10,15,24H,1-3,6-8,11-14H2,(H,21,25) |
| InChIKey | CZFHMQBSVVBTPP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |