C17H19N3O3 — CID 18092760
(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-(1-methylpyrazol-3-yl)prop-2-enamide (PubChem CID 18092760) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-(1-methylpyrazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-(1-methylpyrazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18092760 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-(1-methylpyrazol-3-yl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2ccn(C)n2)cc1OC |
| InChI | InChI=1S/C17H19N3O3/c1-4-11-23-14-7-5-13(12-15(14)22-3)6-8-17(21)18-16-9-10-20(2)19-16/h4-10,12H,1,11H2,2-3H3,(H,18,19,21)/b8-6+ |
| InChIKey | SSNLJENFKPWRCX-SOFGYWHQSA-N |
| XLogP | 2.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|