C13H14N4O6S — CID 18092894
N'-(2-methoxy-5-nitrophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide (PubChem CID 18092894) has the molecular formula C13H14N4O6S and a molecular weight of 354.34 g/mol. Its IUPAC name is N'-(2-methoxy-5-nitrophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide.
| Compound Name | N'-(2-methoxy-5-nitrophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 18092894 |
| Molecular Formula | C13H14N4O6S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N'-(2-methoxy-5-nitrophenyl)sulfonyl-1-methylpyrrole-2-carbohydrazide |
| SMILES | COc1ccc([N+](=O)[O-])cc1S(=O)(=O)NNC(=O)c1cccn1C |
| InChI | InChI=1S/C13H14N4O6S/c1-16-7-3-4-10(16)13(18)14-15-24(21,22)12-8-9(17(19)20)5-6-11(12)23-2/h3-8,15H,1-2H3,(H,14,18) |
| InChIKey | BKPZHFWRYXRQEW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|