C10H11ClN4O2S — CID 18095294
N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine (PubChem CID 18095294) has the molecular formula C10H11ClN4O2S and a molecular weight of 286.74 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine |
|---|---|
| PubChem CID | 18095294 |
| Molecular Formula | C10H11ClN4O2S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine |
| SMILES | CN(Cc1ccc(Cl)s1)c1c([N+](=O)[O-])ncn1C |
| InChI | InChI=1S/C10H11ClN4O2S/c1-13(5-7-3-4-8(11)18-7)10-9(15(16)17)12-6-14(10)2/h3-4,6H,5H2,1-2H3 |
| InChIKey | KHFDFFSCCKTIQU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|