C19H20N2O3 — CID 18097364
2-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopropyl-2-phenylacetamide (PubChem CID 18097364) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopropyl-2-phenylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopropyl-2-phenylacetamide |
|---|---|
| PubChem CID | 18097364 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-N-cyclopropyl-2-phenylacetamide |
| SMILES | O=C(NC1CC1)C(NCc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c22-19(21-15-7-8-15)18(14-4-2-1-3-5-14)20-11-13-6-9-16-17(10-13)24-12-23-16/h1-6,9-10,15,18,20H,7-8,11-12H2,(H,21,22) |
| InChIKey | VXOZZECSMMZLCE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |