C16H12F2N2OS — CID 18099673
2-[(2,3-difluorophenyl)methylsulfanyl]-3-methylquinazolin-4-one (PubChem CID 18099673) has the molecular formula C16H12F2N2OS and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-3-methylquinazolin-4-one.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 18099673 |
| Molecular Formula | C16H12F2N2OS |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-3-methylquinazolin-4-one |
| SMILES | Cn1c(SCc2cccc(F)c2F)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H12F2N2OS/c1-20-15(21)11-6-2-3-8-13(11)19-16(20)22-9-10-5-4-7-12(17)14(10)18/h2-8H,9H2,1H3 |
| InChIKey | PXWHQUUVNRPMGL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |