C17H24N4O4 — CID 18099792
N-(1-cyanocyclohexyl)-N-methyl-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 18099792) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-N-methyl-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-N-methyl-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 18099792 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(1-cyanocyclohexyl)-N-methyl-2-[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CN1C(=O)C(=O)N(CC(=O)N(C)C2(C#N)CCCCC2)C1=O |
| InChI | InChI=1S/C17H24N4O4/c1-12(2)9-20-14(23)15(24)21(16(20)25)10-13(22)19(3)17(11-18)7-5-4-6-8-17/h12H,4-10H2,1-3H3 |
| InChIKey | YAWKWBMMVRPNMY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|