C19H26ClNO5 — CID 18104097
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 3-chloro-5-methoxy-4-propan-2-yloxybenzoate (PubChem CID 18104097) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 3-chloro-5-methoxy-4-propan-2-yloxybenzoate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 3-chloro-5-methoxy-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 18104097 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 3-chloro-5-methoxy-4-propan-2-yloxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N2CCCC(C)C2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H26ClNO5/c1-12(2)26-18-15(20)8-14(9-16(18)24-4)19(23)25-11-17(22)21-7-5-6-13(3)10-21/h8-9,12-13H,5-7,10-11H2,1-4H3 |
| InChIKey | IYZQNUQLCRYIAD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |