C13H15NO3 — CID 18108680
N-(2-phenylethyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 18108680) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(2-phenylethyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(2-phenylethyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 18108680 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(2-phenylethyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1=COCCO1 |
| InChI | InChI=1S/C13H15NO3/c15-13(12-10-16-8-9-17-12)14-7-6-11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,15) |
| InChIKey | AXCBZKUCIQGOLP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |