C13H16N2O2 — CID 20523783
N-(2-phenylethyl)-5,6-dihydro-4H-1,3-oxazine-2-carboxamide (PubChem CID 20523783) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-phenylethyl)-5,6-dihydro-4H-1,3-oxazine-2-carboxamide.
| Compound Name | N-(2-phenylethyl)-5,6-dihydro-4H-1,3-oxazine-2-carboxamide |
|---|---|
| PubChem CID | 20523783 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(2-phenylethyl)-5,6-dihydro-4H-1,3-oxazine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1=NCCCO1 |
| InChI | InChI=1S/C13H16N2O2/c16-12(13-15-8-4-10-17-13)14-9-7-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,14,16) |
| InChIKey | MMLXKYPCTQVMML-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |