C20H20N2O4S — CID 18122399
methyl 3-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 18122399) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is methyl 3-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 3-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 18122399 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | methyl 3-[(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CSc1nc2ccccc2c(=O)n1C1CCCC1 |
| InChI | InChI=1S/C20H20N2O4S/c1-25-19(24)17-13(10-11-26-17)12-27-20-21-16-9-5-4-8-15(16)18(23)22(20)14-6-2-3-7-14/h4-5,8-11,14H,2-3,6-7,12H2,1H3 |
| InChIKey | QZYUNJBWNFJEET-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |