C17H24N4O — CID 18124456
N-(2-cyanoethyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 18124456) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18124456 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(CN2CCN(CC(=O)NCCC#N)CC2)c1 |
| InChI | InChI=1S/C17H24N4O/c1-15-4-2-5-16(12-15)13-20-8-10-21(11-9-20)14-17(22)19-7-3-6-18/h2,4-5,12H,3,7-11,13-14H2,1H3,(H,19,22) |
| InChIKey | WQMIFCXTUDWATQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|