C17H21F3N4O — CID 34706072
N-(2-cyanoethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide (PubChem CID 34706072) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 34706072 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide |
| SMILES | N#CCCNC(=O)CN1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H21F3N4O/c18-17(19,20)15-4-1-3-14(11-15)12-23-7-9-24(10-8-23)13-16(25)22-6-2-5-21/h1,3-4,11H,2,6-10,12-13H2,(H,22,25) |
| InChIKey | UNVVVNSQLIHQKV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|