C13H13N5OS3 — CID 18129886
N-(4-methyl-1,3-thiazol-2-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 18129886) has the molecular formula C13H13N5OS3 and a molecular weight of 351.48 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 18129886 |
| Molecular Formula | C13H13N5OS3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | Cc1csc(NC(=O)CCn2c(-c3cccs3)n[nH]c2=S)n1 |
| InChI | InChI=1S/C13H13N5OS3/c1-8-7-22-12(14-8)15-10(19)4-5-18-11(16-17-13(18)20)9-3-2-6-21-9/h2-3,6-7H,4-5H2,1H3,(H,17,20)(H,14,15,19) |
| InChIKey | AQYOUCAUXHTUNY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|