C20H24N4O2S2 — CID 18133365
2,3,4,5,6-pentamethyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide (PubChem CID 18133365) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18133365 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]phenyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ccccc2Sc2nncn2C)c(C)c1C |
| InChI | InChI=1S/C20H24N4O2S2/c1-12-13(2)15(4)19(16(5)14(12)3)28(25,26)23-17-9-7-8-10-18(17)27-20-22-21-11-24(20)6/h7-11,23H,1-6H3 |
| InChIKey | QUABYEUHMPLXTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |