C21H22N4O — CID 18133538
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indolizine-1-carbonitrile (PubChem CID 18133538) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indolizine-1-carbonitrile.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indolizine-1-carbonitrile |
|---|---|
| PubChem CID | 18133538 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]indolizine-1-carbonitrile |
| SMILES | COc1ccc(N2CCN(Cc3cn4ccccc4c3C#N)CC2)cc1 |
| InChI | InChI=1S/C21H22N4O/c1-26-19-7-5-18(6-8-19)24-12-10-23(11-13-24)15-17-16-25-9-3-2-4-21(25)20(17)14-22/h2-9,16H,10-13,15H2,1H3 |
| InChIKey | WOMLFJIHTJTALM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|