C20H30N4O3 — CID 18140177
1-(2,2-dimethylpropanoyl)-N'-[2-(4-methylanilino)acetyl]piperidine-4-carbohydrazide (PubChem CID 18140177) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N'-[2-(4-methylanilino)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N'-[2-(4-methylanilino)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 18140177 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N'-[2-(4-methylanilino)acetyl]piperidine-4-carbohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)C2CCN(C(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30N4O3/c1-14-5-7-16(8-6-14)21-13-17(25)22-23-18(26)15-9-11-24(12-10-15)19(27)20(2,3)4/h5-8,15,21H,9-13H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | VZPNFXPAWYMMTH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|