C14H13ClN2O3 — CID 18143595
N-[1-(1,3-benzodioxol-5-yl)ethyl]-4-chloro-1H-pyrrole-2-carboxamide (PubChem CID 18143595) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-4-chloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-4-chloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18143595 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-4-chloro-1H-pyrrole-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)c[nH]1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13ClN2O3/c1-8(17-14(18)11-5-10(15)6-16-11)9-2-3-12-13(4-9)20-7-19-12/h2-6,8,16H,7H2,1H3,(H,17,18) |
| InChIKey | LCAZGVNKJGCPCF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |