C16H17NO5S2 — CID 18145478
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 2-[methyl(methylsulfonyl)amino]benzoate (PubChem CID 18145478) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 2-[methyl(methylsulfonyl)amino]benzoate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 2-[methyl(methylsulfonyl)amino]benzoate |
|---|---|
| PubChem CID | 18145478 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 2-[methyl(methylsulfonyl)amino]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccccc2N(C)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H17NO5S2/c1-11-8-9-15(23-11)14(18)10-22-16(19)12-6-4-5-7-13(12)17(2)24(3,20)21/h4-9H,10H2,1-3H3 |
| InChIKey | AUFCWHXUFLCAOC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |