C18H17FN4O2 — CID 18145603
N-[2-(2-fluorophenoxy)ethyl]-4-(1,2,4-triazol-1-ylmethyl)benzamide (PubChem CID 18145603) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-4-(1,2,4-triazol-1-ylmethyl)benzamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-4-(1,2,4-triazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18145603 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-4-(1,2,4-triazol-1-ylmethyl)benzamide |
| SMILES | O=C(NCCOc1ccccc1F)c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C18H17FN4O2/c19-16-3-1-2-4-17(16)25-10-9-21-18(24)15-7-5-14(6-8-15)11-23-13-20-12-22-23/h1-8,12-13H,9-11H2,(H,21,24) |
| InChIKey | KERIWTIILJLSCX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|