C20H17N3O3 — CID 18146549
2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-quinolin-3-ylacetamide (PubChem CID 18146549) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-quinolin-3-ylacetamide.
| Compound Name | 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-quinolin-3-ylacetamide |
|---|---|
| PubChem CID | 18146549 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-quinolin-3-ylacetamide |
| SMILES | CC1Oc2ccccc2N(CC(=O)Nc2cnc3ccccc3c2)C1=O |
| InChI | InChI=1S/C20H17N3O3/c1-13-20(25)23(17-8-4-5-9-18(17)26-13)12-19(24)22-15-10-14-6-2-3-7-16(14)21-11-15/h2-11,13H,12H2,1H3,(H,22,24) |
| InChIKey | IFONKWPSKPJFSE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |