C14H19N5O2S — CID 18154900
3-[3-oxo-3-(4-pyrazin-2-ylpiperazin-1-yl)propyl]-1,3-thiazolidin-2-one (PubChem CID 18154900) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 3-[3-oxo-3-(4-pyrazin-2-ylpiperazin-1-yl)propyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[3-oxo-3-(4-pyrazin-2-ylpiperazin-1-yl)propyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 18154900 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-[3-oxo-3-(4-pyrazin-2-ylpiperazin-1-yl)propyl]-1,3-thiazolidin-2-one |
| SMILES | O=C(CCN1CCSC1=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C14H19N5O2S/c20-13(1-4-19-9-10-22-14(19)21)18-7-5-17(6-8-18)12-11-15-2-3-16-12/h2-3,11H,1,4-10H2 |
| InChIKey | LUAGWQWABQQTRT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|