C14H22N2O4S — CID 62217303
3-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-4-yl]propanoic acid (PubChem CID 62217303) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 62217303 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[1-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperidin-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCN(C(=O)CCN2CCSC2=O)CC1 |
| InChI | InChI=1S/C14H22N2O4S/c17-12(5-8-16-9-10-21-14(16)20)15-6-3-11(4-7-15)1-2-13(18)19/h11H,1-10H2,(H,18,19) |
| InChIKey | LPNIVSUAECZPPU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|