C12H14F3N5OS — CID 18161590
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 18161590) has the molecular formula C12H14F3N5OS and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 18161590 |
| Molecular Formula | C12H14F3N5OS |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)NCC(F)(F)F)c(C)n2n1 |
| InChI | InChI=1S/C12H14F3N5OS/c1-6-8(4-9(21)16-5-12(13,14)15)7(2)20-10(17-6)18-11(19-20)22-3/h4-5H2,1-3H3,(H,16,21) |
| InChIKey | ZJQNQBXKWWEWFH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |