C14H16F3N5O3S — CID 8823642
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 8823642) has the molecular formula C14H16F3N5O3S and a molecular weight of 391.38 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 8823642 |
| Molecular Formula | C14H16F3N5O3S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | CSc1nc2nc(C)c(CC(=O)OCC(=O)NCC(F)(F)F)c(C)n2n1 |
| InChI | InChI=1S/C14H16F3N5O3S/c1-7-9(8(2)22-12(19-7)20-13(21-22)26-3)4-11(24)25-5-10(23)18-6-14(15,16)17/h4-6H2,1-3H3,(H,18,23) |
| InChIKey | RRSSQZLJXWKQRR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |