C14H17F3N6O3 — CID 8914472
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 8914472) has the molecular formula C14H17F3N6O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 8914472 |
| Molecular Formula | C14H17F3N6O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1nc2nc(N)nn2c(C)c1CCC(=O)OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H17F3N6O3/c1-7-9(8(2)23-13(20-7)21-12(18)22-23)3-4-11(25)26-5-10(24)19-6-14(15,16)17/h3-6H2,1-2H3,(H2,18,22)(H,19,24) |
| InChIKey | GKLANHRKFSIIIZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |