C15H18F3N5O3S — CID 8858530
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 8858530) has the molecular formula C15H18F3N5O3S and a molecular weight of 405.40 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 8858530 |
| Molecular Formula | C15H18F3N5O3S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | CSc1nc2nc(C)c(CCC(=O)OCC(=O)NCC(F)(F)F)c(C)n2n1 |
| InChI | InChI=1S/C15H18F3N5O3S/c1-8-10(9(2)23-13(20-8)21-14(22-23)27-3)4-5-12(25)26-6-11(24)19-7-15(16,17)18/h4-7H2,1-3H3,(H,19,24) |
| InChIKey | ZYEKEWFCUZMVLM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |