C15H20F3N5O2S — CID 86979263
2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 86979263) has the molecular formula C15H20F3N5O2S and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86979263 |
| Molecular Formula | C15H20F3N5O2S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)NCCCOCC(F)(F)F)c(C)n2n1 |
| InChI | InChI=1S/C15H20F3N5O2S/c1-9-11(10(2)23-13(20-9)21-14(22-23)26-3)7-12(24)19-5-4-6-25-8-15(16,17)18/h4-8H2,1-3H3,(H,19,24) |
| InChIKey | IEYHSCNWPADZDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|