C20H18ClN3O3S — CID 18166628
2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 18166628) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18166628 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]-methylamino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CN(C(=O)CSc1ncccc1Cl)c1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-24(18(25)13-28-20-16(21)8-4-10-22-20)17-9-3-2-7-15(17)19(26)23-12-14-6-5-11-27-14/h2-11H,12-13H2,1H3,(H,23,26) |
| InChIKey | ILUWNHJMGFHWEV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |