C32H32N2O5Si — CID 18174557
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-4-methoxybenzamide (PubChem CID 18174557) has the molecular formula C32H32N2O5Si and a molecular weight of 552.70 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18174557 |
| Molecular Formula | C32H32N2O5Si |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxobenzo[f]isoindol-2-yl)phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(O[Si](C)(C)C(C)(C)C)cc2N2C(=O)c3cc4ccccc4cc3C2=O)cc1 |
| InChI | InChI=1S/C32H32N2O5Si/c1-32(2,3)40(5,6)39-24-15-16-27(33-29(35)20-11-13-23(38-4)14-12-20)28(19-24)34-30(36)25-17-21-9-7-8-10-22(21)18-26(25)31(34)37/h7-19H,1-6H3,(H,33,35) |
| InChIKey | CLKABSZEZAPGJK-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|