C31H33NO4 — CID 18182717
[6-hydroxy-2-(3-hydroxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 18182717) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is [6-hydroxy-2-(3-hydroxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | [6-hydroxy-2-(3-hydroxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 18182717 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [6-hydroxy-2-(3-hydroxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | O=C(C1=C(c2cccc(O)c2)CCc2cc(O)ccc21)c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C31H33NO4/c33-25-7-4-6-23(20-25)28-14-10-24-21-26(34)11-15-29(24)30(28)31(35)22-8-12-27(13-9-22)36-19-5-18-32-16-2-1-3-17-32/h4,6-9,11-13,15,20-21,33-34H,1-3,5,10,14,16-19H2 |
| InChIKey | OTKFRZCUUJBVDH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|