About 1-fluoropyrrol-2-ol
1-fluoropyrrol-2-ol (PubChem CID 18185037) has the molecular formula C4H4FNO
and a molecular weight of 101.08 g/mol. Its IUPAC name is 1-fluoropyrrol-2-ol.
Molecular Properties
| Compound Name | 1-fluoropyrrol-2-ol |
| PubChem CID | 18185037 |
| Molecular Formula | C4H4FNO |
| Molecular Weight | 101.08 g/mol |
| Exact Mass | 101.03 |
| IUPAC Name | 1-fluoropyrrol-2-ol |
| SMILES | Oc1cccn1F |
| InChI | InChI=1S/C4H4FNO/c5-6-3-1-2-4(6)7/h1-3,7H |
| InChIKey | IZPONHVLASHXKO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.08 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoropyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropyrrol-2-ol?
The IUPAC name of 1-fluoropyrrol-2-ol (CID 18185037) is 1-fluoropyrrol-2-ol.
What is the SMILES notation for 1-fluoropyrrol-2-ol?
The canonical SMILES for 1-fluoropyrrol-2-ol is Oc1cccn1F.
What is the InChIKey of 1-fluoropyrrol-2-ol?
The InChIKey is IZPONHVLASHXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4FNO/c5-6-3-1-2-4(6)7/h1-3,7H.
What are the key properties of 1-fluoropyrrol-2-ol?
1-fluoropyrrol-2-ol has a molecular weight of 101.08 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropyrrol-2-ol is sourced from PubChem (CID 18185037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).