C21H15F3O8S2 — CID 18185296
2-[4-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]sulfonylphenoxy]acetic acid (PubChem CID 18185296) has the molecular formula C21H15F3O8S2 and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[4-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]sulfonylphenoxy]acetic acid.
| Compound Name | 2-[4-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]sulfonylphenoxy]acetic acid |
|---|---|
| PubChem CID | 18185296 |
| Molecular Formula | C21H15F3O8S2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2-[4-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]sulfonylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)c2ccc(Oc3ccc(S(=O)(=O)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H15F3O8S2/c22-21(23,24)34(29,30)19-11-5-16(6-12-19)32-15-3-9-18(10-4-15)33(27,28)17-7-1-14(2-8-17)31-13-20(25)26/h1-12H,13H2,(H,25,26) |
| InChIKey | HPUMINICUWYONF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |