C19H18FNOS — CID 18186998
9-(3-ethenyl-4-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 18186998) has the molecular formula C19H18FNOS and a molecular weight of 327.42 g/mol. Its IUPAC name is 9-(3-ethenyl-4-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(3-ethenyl-4-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 18186998 |
| Molecular Formula | C19H18FNOS |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 9-(3-ethenyl-4-fluorophenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | C=Cc1cc(C2C3=C(CCS3)NC3=C2C(=O)CCC3)ccc1F |
| InChI | InChI=1S/C19H18FNOS/c1-2-11-10-12(6-7-13(11)20)17-18-14(4-3-5-16(18)22)21-15-8-9-23-19(15)17/h2,6-7,10,17,21H,1,3-5,8-9H2 |
| InChIKey | XZIGRFAPCABWSR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |