C19H20BrNOS — CID 18187153
9-(3-bromo-4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 18187153) has the molecular formula C19H20BrNOS and a molecular weight of 390.35 g/mol. Its IUPAC name is 9-(3-bromo-4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(3-bromo-4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 18187153 |
| Molecular Formula | C19H20BrNOS |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 9-(3-bromo-4-ethylphenyl)-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | CCc1ccc(C2C3=C(CCS3)NC3=C2C(=O)CCC3)cc1Br |
| InChI | InChI=1S/C19H20BrNOS/c1-2-11-6-7-12(10-13(11)20)17-18-14(4-3-5-16(18)22)21-15-8-9-23-19(15)17/h6-7,10,17,21H,2-5,8-9H2,1H3 |
| InChIKey | XZIWWSIIEQQXAA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |